C15H25NO4S — CID 110757529
5-tert-butyl-2-methoxy-N-(3-methoxypropyl)benzenesulfonamide (PubChem CID 110757529) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is 5-tert-butyl-2-methoxy-N-(3-methoxypropyl)benzenesulfonamide.
| Compound Name | 5-tert-butyl-2-methoxy-N-(3-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110757529 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 5-tert-butyl-2-methoxy-N-(3-methoxypropyl)benzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1cc(C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C15H25NO4S/c1-15(2,3)12-7-8-13(20-5)14(11-12)21(17,18)16-9-6-10-19-4/h7-8,11,16H,6,9-10H2,1-5H3 |
| InChIKey | URJCPYRFSKRRHW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|