C12H19NO6S2 — CID 110300192
2-methoxy-N-(3-methoxypropyl)-5-methylsulfonylbenzenesulfonamide (PubChem CID 110300192) has the molecular formula C12H19NO6S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-methoxy-N-(3-methoxypropyl)-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-methoxy-N-(3-methoxypropyl)-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 110300192 |
| Molecular Formula | C12H19NO6S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-methoxy-N-(3-methoxypropyl)-5-methylsulfonylbenzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C12H19NO6S2/c1-18-8-4-7-13-21(16,17)12-9-10(20(3,14)15)5-6-11(12)19-2/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | QXFDALVNSCNYPO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|