C14H23N3O5S2 — CID 120999802
2-methoxy-5-methylsulfonyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 120999802) has the molecular formula C14H23N3O5S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-methoxy-5-methylsulfonyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | 2-methoxy-5-methylsulfonyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120999802 |
| Molecular Formula | C14H23N3O5S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-methoxy-5-methylsulfonyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C14H23N3O5S2/c1-22-13-4-3-12(23(2,18)19)11-14(13)24(20,21)16-7-10-17-8-5-15-6-9-17/h3-4,11,15-16H,5-10H2,1-2H3 |
| InChIKey | MKIQGUNNYVHXBN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |