C13H22BrCl2N3O3S — CID 119966428
2-bromo-5-methoxy-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride (PubChem CID 119966428) has the molecular formula C13H22BrCl2N3O3S and a molecular weight of 451.21 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride.
| Compound Name | 2-bromo-5-methoxy-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119966428 |
| Molecular Formula | C13H22BrCl2N3O3S |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 2-bromo-5-methoxy-N-(2-piperazin-1-ylethyl)benzenesulfonamide;dihydrochloride |
| SMILES | COc1ccc(Br)c(S(=O)(=O)NCCN2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C13H20BrN3O3S.2ClH/c1-20-11-2-3-12(14)13(10-11)21(18,19)16-6-9-17-7-4-15-5-8-17;;/h2-3,10,15-16H,4-9H2,1H3;2*1H |
| InChIKey | ORNOCILELXKOCR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |