C28H43NO5S — CID 19681035
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 19681035) has the molecular formula C28H43NO5S and a molecular weight of 505.72 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 19681035 |
| Molecular Formula | C28H43NO5S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNS(=O)(=O)c2cc(OC)ccc2OC)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C28H43NO5S/c1-9-27(3,4)21-13-15-24(23(19-21)28(5,6)10-2)34-18-12-11-17-29-35(30,31)26-20-22(32-7)14-16-25(26)33-8/h13-16,19-20,29H,9-12,17-18H2,1-8H3 |
| InChIKey | JOXGYAHYRDDSGI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|