C26H41N3O3S — CID 70362253
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-hydrazinylbenzenesulfonamide (PubChem CID 70362253) has the molecular formula C26H41N3O3S and a molecular weight of 475.70 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-hydrazinylbenzenesulfonamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-hydrazinylbenzenesulfonamide |
|---|---|
| PubChem CID | 70362253 |
| Molecular Formula | C26H41N3O3S |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-hydrazinylbenzenesulfonamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNS(=O)(=O)c2ccc(NN)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C26H41N3O3S/c1-7-25(3,4)20-11-16-24(23(19-20)26(5,6)8-2)32-18-10-9-17-28-33(30,31)22-14-12-21(29-27)13-15-22/h11-16,19,28-29H,7-10,17-18,27H2,1-6H3 |
| InChIKey | OYBHDWZIOQRPKV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|