C22H32N2O — CID 91743230
[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]phenyl]hydrazine (PubChem CID 91743230) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is [4-[2,4-bis(2-methylbutan-2-yl)phenoxy]phenyl]hydrazine.
| Compound Name | [4-[2,4-bis(2-methylbutan-2-yl)phenoxy]phenyl]hydrazine |
|---|---|
| PubChem CID | 91743230 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | [4-[2,4-bis(2-methylbutan-2-yl)phenoxy]phenyl]hydrazine |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NN)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C22H32N2O/c1-7-21(3,4)16-9-14-20(19(15-16)22(5,6)8-2)25-18-12-10-17(24-23)11-13-18/h9-15,24H,7-8,23H2,1-6H3 |
| InChIKey | JWFFOJYFBZBMHN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|