C27H39NO3 — CID 19373450
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-tert-butyl-5-hydroxybenzamide (PubChem CID 19373450) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-tert-butyl-5-hydroxybenzamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-tert-butyl-5-hydroxybenzamide |
|---|---|
| PubChem CID | 19373450 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-tert-butyl-5-hydroxybenzamide |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(O)cc2C(=O)NC(C)(C)C)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C27H39NO3/c1-10-26(6,7)18-12-14-23(21(16-18)27(8,9)11-2)31-22-15-13-19(29)17-20(22)24(30)28-25(3,4)5/h12-17,29H,10-11H2,1-9H3,(H,28,30) |
| InChIKey | RFLLNFDWPNIFCE-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |