C31H38N2O4 — CID 19385793
methyl 3-[[5-amino-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]benzoyl]amino]benzoate (PubChem CID 19385793) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is methyl 3-[[5-amino-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[5-amino-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 19385793 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | methyl 3-[[5-amino-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]benzoyl]amino]benzoate |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(N)cc2C(=O)Nc2cccc(C(=O)OC)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C31H38N2O4/c1-8-30(3,4)21-13-15-27(25(18-21)31(5,6)9-2)37-26-16-14-22(32)19-24(26)28(34)33-23-12-10-11-20(17-23)29(35)36-7/h10-19H,8-9,32H2,1-7H3,(H,33,34) |
| InChIKey | HGDWZADZJKRDAL-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|