C34H42N2O5 — CID 22765488
3-[3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-2-methoxy-3-oxo-N-phenylpropanamide (PubChem CID 22765488) has the molecular formula C34H42N2O5 and a molecular weight of 558.72 g/mol. Its IUPAC name is 3-[3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-2-methoxy-3-oxo-N-phenylpropanamide.
| Compound Name | 3-[3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-2-methoxy-3-oxo-N-phenylpropanamide |
|---|---|
| PubChem CID | 22765488 |
| Molecular Formula | C34H42N2O5 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 3-[3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]phenyl]-2-methoxy-3-oxo-N-phenylpropanamide |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Nc2cccc(C(=O)C(OC)C(=O)Nc3ccccc3)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C34H42N2O5/c1-8-33(3,4)24-18-19-28(27(21-24)34(5,6)9-2)41-22-29(37)35-26-17-13-14-23(20-26)30(38)31(40-7)32(39)36-25-15-11-10-12-16-25/h10-21,31H,8-9,22H2,1-7H3,(H,35,37)(H,36,39) |
| InChIKey | FKZBXSJWAQZFKJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|