C26H32N2O3 — CID 56698539
4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzoyl cyanide (PubChem CID 56698539) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzoyl cyanide.
| Compound Name | 4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzoyl cyanide |
|---|---|
| PubChem CID | 56698539 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 4-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzoyl cyanide |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Nc2ccc(C(=O)C#N)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C26H32N2O3/c1-7-25(3,4)19-11-14-23(21(15-19)26(5,6)8-2)31-17-24(30)28-20-12-9-18(10-13-20)22(29)16-27/h9-15H,7-8,17H2,1-6H3,(H,28,30) |
| InChIKey | OIBFOEXSKMIMNG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|