C23H30N4O2 — CID 58892697
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(6-isocyanopyridazin-3-yl)acetamide (PubChem CID 58892697) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(6-isocyanopyridazin-3-yl)acetamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(6-isocyanopyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 58892697 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(6-isocyanopyridazin-3-yl)acetamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)COc2ccc(C(C)(C)CC)cc2C(C)(C)CC)nn1 |
| InChI | InChI=1S/C23H30N4O2/c1-8-22(3,4)16-10-11-18(17(14-16)23(5,6)9-2)29-15-21(28)25-20-13-12-19(24-7)26-27-20/h10-14H,8-9,15H2,1-6H3,(H,25,27,28) |
| InChIKey | USEUQQUQHHPHNN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|