C22H40O — CID 145478769
1-butoxy-2,4-bis(2-methylbutan-2-yl)benzene;ethane (PubChem CID 145478769) has the molecular formula C22H40O and a molecular weight of 320.56 g/mol. Its IUPAC name is 1-butoxy-2,4-bis(2-methylbutan-2-yl)benzene;ethane.
| Compound Name | 1-butoxy-2,4-bis(2-methylbutan-2-yl)benzene;ethane |
|---|---|
| PubChem CID | 145478769 |
| Molecular Formula | C22H40O |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | 1-butoxy-2,4-bis(2-methylbutan-2-yl)benzene;ethane |
| SMILES | CC.CCCCOc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
| InChI | InChI=1S/C20H34O.C2H6/c1-8-11-14-21-18-13-12-16(19(4,5)9-2)15-17(18)20(6,7)10-3;1-2/h12-13,15H,8-11,14H2,1-7H3;1-2H3 |
| InChIKey | FBJBNUMJKFQLJV-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|