C21H39NO3S — CID 158846355
N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]methanesulfonamide;methane (PubChem CID 158846355) has the molecular formula C21H39NO3S and a molecular weight of 385.61 g/mol. Its IUPAC name is N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]methanesulfonamide;methane.
| Compound Name | N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]methanesulfonamide;methane |
|---|---|
| PubChem CID | 158846355 |
| Molecular Formula | C21H39NO3S |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]methanesulfonamide;methane |
| SMILES | C.CCC(C)(C)c1ccc(OCCCNS(C)(=O)=O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C20H35NO3S.CH4/c1-8-19(3,4)16-11-12-18(17(15-16)20(5,6)9-2)24-14-10-13-21-25(7,22)23;/h11-12,15,21H,8-10,13-14H2,1-7H3;1H4 |
| InChIKey | IYWRIIQXCIUPOH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|