C26H38N2O5S — CID 19681044
N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-nitrobenzenesulfonamide (PubChem CID 19681044) has the molecular formula C26H38N2O5S and a molecular weight of 490.67 g/mol. Its IUPAC name is N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 19681044 |
| Molecular Formula | C26H38N2O5S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-2-nitrobenzenesulfonamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNS(=O)(=O)c2ccccc2[N+](=O)[O-])c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C26H38N2O5S/c1-7-25(3,4)20-15-16-23(21(19-20)26(5,6)8-2)33-18-12-11-17-27-34(31,32)24-14-10-9-13-22(24)28(29)30/h9-10,13-16,19,27H,7-8,11-12,17-18H2,1-6H3 |
| InChIKey | PDOFFUXRBMKELM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|