C46H67N2NaO7S — CID 23684650
sodium 3,5-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]benzenesulfonate (PubChem CID 23684650) has the molecular formula C46H67N2NaO7S and a molecular weight of 815.11 g/mol. Its IUPAC name is sodium 3,5-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]benzenesulfonate.
| Compound Name | sodium 3,5-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 23684650 |
| Molecular Formula | C46H67N2NaO7S |
| Molecular Weight | 815.11 g/mol |
| Exact Mass | 814.46 |
| IUPAC Name | sodium 3,5-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propylcarbamoyl]benzenesulfonate |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2cc(C(=O)NCCCOc3ccc(C(C)(C)CC)cc3C(C)(C)CC)cc(S(=O)(=O)[O-])c2)c(C(C)(C)CC)c1.[Na+] |
| InChI | InChI=1S/C46H68N2O7S.Na/c1-13-43(5,6)34-19-21-39(37(30-34)45(9,10)15-3)54-25-17-23-47-41(49)32-27-33(29-36(28-32)56(51,52)53)42(50)48-24-18-26-55-40-22-20-35(44(7,8)14-2)31-38(40)46(11,12)16-4;/h19-22,27-31H,13-18,23-26H2,1-12H3,(H,47,49)(H,48,50)(H,51,52,53);/q;+1/p-1 |
| InChIKey | JJUWNSWBVWWCTH-UHFFFAOYSA-M |
| XLogP | 6.74 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.11 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|