About [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene
[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene (PubChem CID 54018984) has the molecular formula C26H38N2O2
and a molecular weight of 410.60 g/mol. Its IUPAC name is [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene.
Molecular Properties
| Compound Name | [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene |
| PubChem CID | 54018984 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene |
| SMILES | [H]/N=N/c1ccc(OCCCCOc2ccc(C(C)(C)CC)cc2C(C)(C)CC)cc1 |
| InChI | InChI=1S/C26H38N2O2/c1-7-25(3,4)20-11-16-24(23(19-20)26(5,6)8-2)30-18-10-9-17-29-22-14-12-21(28-27)13-15-22/h11-16,19,27H,7-10,17-18H2,1-6H3/b28-27+ |
| InChIKey | KXPDITTVBBDTRH-BYYHNAKLSA-N |
| XLogP | 7.96 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene?
The IUPAC name of [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene (CID 54018984) is [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene.
What is the SMILES notation for [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene?
The canonical SMILES for [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene is [H]/N=N/c1ccc(OCCCCOc2ccc(C(C)(C)CC)cc2C(C)(C)CC)cc1.
What is the InChIKey of [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene?
The InChIKey is KXPDITTVBBDTRH-BYYHNAKLSA-N. The full InChI is InChI=1S/C26H38N2O2/c1-7-25(3,4)20-11-16-24(23(19-20)26(5,6)8-2)30-18-10-9-17-29-22-14-12-21(28-27)13-15-22/h11-16,19,27H,7-10,17-18H2,1-6H3/b28-27+.
What are the key properties of [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene?
[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene has a molecular weight of 410.60 g/mol, XLogP of 7.96, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butoxy]phenyl]diazene is sourced from PubChem (CID 54018984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).