C22H34N4O2 — CID 2944452
1-(3-amino-1,2,4-triazol-4-yl)-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-1-one (PubChem CID 2944452) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-(3-amino-1,2,4-triazol-4-yl)-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-1-one.
| Compound Name | 1-(3-amino-1,2,4-triazol-4-yl)-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-1-one |
|---|---|
| PubChem CID | 2944452 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-(3-amino-1,2,4-triazol-4-yl)-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-1-one |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)n2cnnc2N)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C22H34N4O2/c1-7-21(3,4)16-11-12-18(17(14-16)22(5,6)8-2)28-13-9-10-19(27)26-15-24-25-20(26)23/h11-12,14-15H,7-10,13H2,1-6H3,(H2,23,25) |
| InChIKey | CHPPYXWNLHDEAX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|