C26H38N2O3 — CID 6908227
4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(E)-(5-methylfuran-2-yl)methylideneamino]butanamide (PubChem CID 6908227) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(E)-(5-methylfuran-2-yl)methylideneamino]butanamide.
| Compound Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(E)-(5-methylfuran-2-yl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 6908227 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(E)-(5-methylfuran-2-yl)methylideneamino]butanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)N/N=C/c2ccc(C)o2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C26H38N2O3/c1-8-25(4,5)20-13-15-23(22(17-20)26(6,7)9-2)30-16-10-11-24(29)28-27-18-21-14-12-19(3)31-21/h12-15,17-18H,8-11,16H2,1-7H3,(H,28,29)/b27-18+ |
| InChIKey | LEYXQOKLFKJPEA-OVVQPSECSA-N |
| XLogP | 6.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|