C34H46N4O3S — CID 6041310
4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]butanamide (PubChem CID 6041310) has the molecular formula C34H46N4O3S and a molecular weight of 590.83 g/mol. Its IUPAC name is 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]butanamide.
| Compound Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 6041310 |
| Molecular Formula | C34H46N4O3S |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]butanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)N/N=C\c2sc(N3CCOCC3)nc2-c2ccccc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C34H46N4O3S/c1-7-33(3,4)26-16-17-28(27(23-26)34(5,6)8-2)41-20-12-15-30(39)37-35-24-29-31(25-13-10-9-11-14-25)36-32(42-29)38-18-21-40-22-19-38/h9-11,13-14,16-17,23-24H,7-8,12,15,18-22H2,1-6H3,(H,37,39)/b35-24- |
| InChIKey | MSBUITIFEPTCBC-BGDIREAQSA-N |
| XLogP | 7.33 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|