C25H27N5O5S2 — CID 4189761
N-[(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 4189761) has the molecular formula C25H27N5O5S2 and a molecular weight of 541.66 g/mol. Its IUPAC name is N-[(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4189761 |
| Molecular Formula | C25H27N5O5S2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N-[(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NN=Cc1sc(N2CCOCC2)nc1-c1ccccc1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H27N5O5S2/c31-24(20-7-4-8-21(17-20)37(32,33)30-11-15-35-16-12-30)28-26-18-22-23(19-5-2-1-3-6-19)27-25(36-22)29-9-13-34-14-10-29/h1-8,17-18H,9-16H2,(H,28,31) |
| InChIKey | JNSJPUIQGSLHTD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|