C18H17F2N3O4S — CID 2588987
N-[(2,4-difluorophenyl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 2588987) has the molecular formula C18H17F2N3O4S and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(2,4-difluorophenyl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2588987 |
| Molecular Formula | C18H17F2N3O4S |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-[(2,4-difluorophenyl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NN=Cc1ccc(F)cc1F)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H17F2N3O4S/c19-15-5-4-14(17(20)11-15)12-21-22-18(24)13-2-1-3-16(10-13)28(25,26)23-6-8-27-9-7-23/h1-5,10-12H,6-9H2,(H,22,24) |
| InChIKey | QNZQNJRJPRSMGK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|