C19H19F2N3O3S — CID 2589534
N-[(2,4-difluorophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 2589534) has the molecular formula C19H19F2N3O3S and a molecular weight of 407.44 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(2,4-difluorophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2589534 |
| Molecular Formula | C19H19F2N3O3S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[(2,4-difluorophenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NN=Cc1ccc(F)cc1F)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H19F2N3O3S/c20-16-8-7-15(18(21)12-16)13-22-23-19(25)14-5-4-6-17(11-14)28(26,27)24-9-2-1-3-10-24/h4-8,11-13H,1-3,9-10H2,(H,23,25) |
| InChIKey | ZJMOSUAQJMDVDW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|