C20H23N3O3S2 — CID 5099990
N-[(4-methylsulfanylphenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 5099990) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(4-methylsulfanylphenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 5099990 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CSc1ccc(C=NNC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-27-18-10-8-16(9-11-18)15-21-22-20(24)17-6-5-7-19(14-17)28(25,26)23-12-3-2-4-13-23/h5-11,14-15H,2-4,12-13H2,1H3,(H,22,24) |
| InChIKey | UXXNJSIIGCNDFM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|