C19H20F2N2O4S — CID 84834881
N-[1-(2,4-difluorophenyl)ethyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 84834881) has the molecular formula C19H20F2N2O4S and a molecular weight of 410.44 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 84834881 |
| Molecular Formula | C19H20F2N2O4S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H20F2N2O4S/c1-13(17-6-5-15(20)12-18(17)21)22-19(24)14-3-2-4-16(11-14)28(25,26)23-7-9-27-10-8-23/h2-6,11-13H,7-10H2,1H3,(H,22,24) |
| InChIKey | XUOCQMGJNXMWGC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |