C22H22N4O2S — CID 155531820
(E)-N-(2-aminophenyl)-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enamide (PubChem CID 155531820) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 155531820 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1sc(N2CCOCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H22N4O2S/c23-17-8-4-5-9-18(17)24-20(27)11-10-19-21(16-6-2-1-3-7-16)25-22(29-19)26-12-14-28-15-13-26/h1-11H,12-15,23H2,(H,24,27)/b11-10+ |
| InChIKey | AICSJAMKKBBOCF-ZHACJKMWSA-N |
| XLogP | 3.88 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|