C25H26ClN3O5S — CID 155537493
(E)-3-[4-(4-chlorophenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]-N-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 155537493) has the molecular formula C25H26ClN3O5S and a molecular weight of 516.02 g/mol. Its IUPAC name is (E)-3-[4-(4-chlorophenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]-N-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(4-chlorophenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 155537493 |
| Molecular Formula | C25H26ClN3O5S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | (E)-3-[4-(4-chlorophenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2sc(N3CCOCC3)nc2-c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H26ClN3O5S/c1-31-19-14-18(15-20(32-2)24(19)33-3)27-22(30)9-8-21-23(16-4-6-17(26)7-5-16)28-25(35-21)29-10-12-34-13-11-29/h4-9,14-15H,10-13H2,1-3H3,(H,27,30)/b9-8+ |
| InChIKey | KDQMNWLPMNYSNX-CMDGGOBGSA-N |
| XLogP | 4.98 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|