C22H21N5O4S — CID 155512974
(E)-N-(2-aminophenyl)-3-[2-morpholin-4-yl-4-(4-nitrophenyl)-1,3-thiazol-5-yl]prop-2-enamide (PubChem CID 155512974) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[2-morpholin-4-yl-4-(4-nitrophenyl)-1,3-thiazol-5-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[2-morpholin-4-yl-4-(4-nitrophenyl)-1,3-thiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 155512974 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[2-morpholin-4-yl-4-(4-nitrophenyl)-1,3-thiazol-5-yl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1sc(N2CCOCC2)nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21N5O4S/c23-17-3-1-2-4-18(17)24-20(28)10-9-19-21(15-5-7-16(8-6-15)27(29)30)25-22(32-19)26-11-13-31-14-12-26/h1-10H,11-14,23H2,(H,24,28)/b10-9+ |
| InChIKey | MOYRNOXDMXYBLN-MDZDMXLPSA-N |
| XLogP | 3.79 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|