C18H23N5O5 — CID 90544408
1-(6-morpholin-4-ylpyrimidin-4-yl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 90544408) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 1-(6-morpholin-4-ylpyrimidin-4-yl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(6-morpholin-4-ylpyrimidin-4-yl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 90544408 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-(6-morpholin-4-ylpyrimidin-4-yl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2cc(N3CCOCC3)ncn2)cc(OC)c1OC |
| InChI | InChI=1S/C18H23N5O5/c1-25-13-8-12(9-14(26-2)17(13)27-3)21-18(24)22-15-10-16(20-11-19-15)23-4-6-28-7-5-23/h8-11H,4-7H2,1-3H3,(H2,19,20,21,22,24) |
| InChIKey | FPEBDHXIIHMKRP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |