C24H27N5O4 — CID 90545207
3,4,5-trimethoxy-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]benzamide (PubChem CID 90545207) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 90545207 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)cc(OC)c1OC |
| InChI | InChI=1S/C24H27N5O4/c1-31-19-13-17(14-20(32-2)23(19)33-3)24(30)27-21-15-22(26-16-25-21)29-11-9-28(10-12-29)18-7-5-4-6-8-18/h4-8,13-16H,9-12H2,1-3H3,(H,25,26,27,30) |
| InChIKey | WLUAZTLCFKRAAA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |