C22H20F3N5O — CID 90545273
N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-4-(trifluoromethyl)benzamide (PubChem CID 90545273) has the molecular formula C22H20F3N5O and a molecular weight of 427.43 g/mol. Its IUPAC name is N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90545273 |
| Molecular Formula | C22H20F3N5O |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cc(N2CCN(c3ccccc3)CC2)ncn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F3N5O/c23-22(24,25)17-8-6-16(7-9-17)21(31)28-19-14-20(27-15-26-19)30-12-10-29(11-13-30)18-4-2-1-3-5-18/h1-9,14-15H,10-13H2,(H,26,27,28,31) |
| InChIKey | HAQGYPPGWOWLAD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |