C22H21F3N6O — CID 90545480
1-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 90545480) has the molecular formula C22H21F3N6O and a molecular weight of 442.45 g/mol. Its IUPAC name is 1-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90545480 |
| Molecular Formula | C22H21F3N6O |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cc(N2CCN(c3ccccc3)CC2)ncn1 |
| InChI | InChI=1S/C22H21F3N6O/c23-22(24,25)16-6-8-17(9-7-16)28-21(32)29-19-14-20(27-15-26-19)31-12-10-30(11-13-31)18-4-2-1-3-5-18/h1-9,14-15H,10-13H2,(H2,26,27,28,29,32) |
| InChIKey | RPUVXKLYTCEEIU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |