C21H20F2N6O — CID 90545478
1-(3,4-difluorophenyl)-3-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]urea (PubChem CID 90545478) has the molecular formula C21H20F2N6O and a molecular weight of 410.43 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 90545478 |
| Molecular Formula | C21H20F2N6O |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1cc(N2CCN(c3ccccc3)CC2)ncn1 |
| InChI | InChI=1S/C21H20F2N6O/c22-17-7-6-15(12-18(17)23)26-21(30)27-19-13-20(25-14-24-19)29-10-8-28(9-11-29)16-4-2-1-3-5-16/h1-7,12-14H,8-11H2,(H2,24,25,26,27,30) |
| InChIKey | MEUFZKVLZBDPRW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |