C23H25FN6O — CID 90545857
1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(3-fluoro-4-methylphenyl)urea (PubChem CID 90545857) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(3-fluoro-4-methylphenyl)urea.
| Compound Name | 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(3-fluoro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 90545857 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(3-fluoro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)cc1F |
| InChI | InChI=1S/C23H25FN6O/c1-17-7-8-19(13-20(17)24)27-23(31)28-21-14-22(26-16-25-21)30-11-9-29(10-12-30)15-18-5-3-2-4-6-18/h2-8,13-14,16H,9-12,15H2,1H3,(H2,25,26,27,28,31) |
| InChIKey | FKZNBESNHBMTLP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |