C22H30N6O — CID 90545849
1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-cyclohexylurea (PubChem CID 90545849) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-cyclohexylurea.
| Compound Name | 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 90545849 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-cyclohexylurea |
| SMILES | O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)NC1CCCCC1 |
| InChI | InChI=1S/C22H30N6O/c29-22(25-19-9-5-2-6-10-19)26-20-15-21(24-17-23-20)28-13-11-27(12-14-28)16-18-7-3-1-4-8-18/h1,3-4,7-8,15,17,19H,2,5-6,9-14,16H2,(H2,23,24,25,26,29) |
| InChIKey | ORJAFLBHZBZAOD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |