C24H28N6O2 — CID 90545898
1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(2-phenoxyethyl)urea (PubChem CID 90545898) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(2-phenoxyethyl)urea.
| Compound Name | 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(2-phenoxyethyl)urea |
|---|---|
| PubChem CID | 90545898 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-3-(2-phenoxyethyl)urea |
| SMILES | O=C(NCCOc1ccccc1)Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1 |
| InChI | InChI=1S/C24H28N6O2/c31-24(25-11-16-32-21-9-5-2-6-10-21)28-22-17-23(27-19-26-22)30-14-12-29(13-15-30)18-20-7-3-1-4-8-20/h1-10,17,19H,11-16,18H2,(H2,25,26,27,28,31) |
| InChIKey | DLZMJJNAFOUAEJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|