C20H32N6O — CID 23652956
1-cyclohexyl-3-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]urea (PubChem CID 23652956) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 23652956 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-cyclohexyl-3-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]urea |
| SMILES | O=C(Nc1cc(N2CCN(C3CCCC3)CC2)ncn1)NC1CCCCC1 |
| InChI | InChI=1S/C20H32N6O/c27-20(23-16-6-2-1-3-7-16)24-18-14-19(22-15-21-18)26-12-10-25(11-13-26)17-8-4-5-9-17/h14-17H,1-13H2,(H2,21,22,23,24,27) |
| InChIKey | NZWKRMMJLVKNEX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |