C18H28N6O — CID 23652954
N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidine-1-carboxamide (PubChem CID 23652954) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 23652954 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cc(N2CCN(C3CCCC3)CC2)ncn1)N1CCCC1 |
| InChI | InChI=1S/C18H28N6O/c25-18(24-7-3-4-8-24)21-16-13-17(20-14-19-16)23-11-9-22(10-12-23)15-5-1-2-6-15/h13-15H,1-12H2,(H,19,20,21,25) |
| InChIKey | HFLFUMZNCVTSDM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |