C15H23N5O — CID 71795117
N-cyclopentyl-4-(6-methylpyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 71795117) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is N-cyclopentyl-4-(6-methylpyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-cyclopentyl-4-(6-methylpyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 71795117 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-cyclopentyl-4-(6-methylpyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | Cc1cc(N2CCN(C(=O)NC3CCCC3)CC2)ncn1 |
| InChI | InChI=1S/C15H23N5O/c1-12-10-14(17-11-16-12)19-6-8-20(9-7-19)15(21)18-13-4-2-3-5-13/h10-11,13H,2-9H2,1H3,(H,18,21) |
| InChIKey | OESUMBYIROZSCO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |