C21H29N5O3 — CID 22707685
N-cyclohexyl-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide (PubChem CID 22707685) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-cyclohexyl-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22707685 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-cyclohexyl-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=O)NC4CCCCC4)CC3)c2cc1OC |
| InChI | InChI=1S/C21H29N5O3/c1-28-18-12-16-17(13-19(18)29-2)22-14-23-20(16)25-8-10-26(11-9-25)21(27)24-15-6-4-3-5-7-15/h12-15H,3-11H2,1-2H3,(H,24,27) |
| InChIKey | FNGALUVCGZXYEO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |