C11H18N6 — CID 80929365
[6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidin-4-yl]hydrazine (PubChem CID 80929365) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80929365 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(N2CCN3CCCC3C2)ncn1 |
| InChI | InChI=1S/C11H18N6/c12-15-10-6-11(14-8-13-10)17-5-4-16-3-1-2-9(16)7-17/h6,8-9H,1-5,7,12H2,(H,13,14,15) |
| InChIKey | LHFYQRCLFWFIAG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|