C13H21N5S — CID 80854581
6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80854581) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80854581 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1cc(N2CCN3CCCC3C2)nc(SC)n1 |
| InChI | InChI=1S/C13H21N5S/c1-14-11-8-12(16-13(15-11)19-2)18-7-6-17-5-3-4-10(17)9-18/h8,10H,3-7,9H2,1-2H3,(H,14,15,16) |
| InChIKey | WKIDPGLERICFLF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |