C14H25N5S — CID 80796740
6-(4-tert-butylpiperazin-1-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80796740) has the molecular formula C14H25N5S and a molecular weight of 295.46 g/mol. Its IUPAC name is 6-(4-tert-butylpiperazin-1-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(4-tert-butylpiperazin-1-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80796740 |
| Molecular Formula | C14H25N5S |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 6-(4-tert-butylpiperazin-1-yl)-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1cc(N2CCN(C(C)(C)C)CC2)nc(SC)n1 |
| InChI | InChI=1S/C14H25N5S/c1-14(2,3)19-8-6-18(7-9-19)12-10-11(15-4)16-13(17-12)20-5/h10H,6-9H2,1-5H3,(H,15,16,17) |
| InChIKey | ROCKTGPHUMZBKO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |