C13H23N5OS — CID 80779556
2-[4-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 80779556) has the molecular formula C13H23N5OS and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-[4-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 80779556 |
| Molecular Formula | C13H23N5OS |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[4-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | CCNc1cc(N2CCN(CCO)CC2)nc(SC)n1 |
| InChI | InChI=1S/C13H23N5OS/c1-3-14-11-10-12(16-13(15-11)20-2)18-6-4-17(5-7-18)8-9-19/h10,19H,3-9H2,1-2H3,(H,14,15,16) |
| InChIKey | QGHOJPMGUTXWDJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |