C15H25N5S — CID 80836949
6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80836949) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80836949 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-ethyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCNc1cc(N2CCN3CCCCC3C2)nc(SC)n1 |
| InChI | InChI=1S/C15H25N5S/c1-3-16-13-10-14(18-15(17-13)21-2)20-9-8-19-7-5-4-6-12(19)11-20/h10,12H,3-9,11H2,1-2H3,(H,16,17,18) |
| InChIKey | SIEQPLJNKLCGQD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |