C16H27N5 — CID 80836941
4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-methyl-N-propylpyrimidin-2-amine (PubChem CID 80836941) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-methyl-N-propylpyrimidin-2-amine.
| Compound Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-methyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80836941 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-methyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nc(C)cc(N2CCN3CCCCC3C2)n1 |
| InChI | InChI=1S/C16H27N5/c1-3-7-17-16-18-13(2)11-15(19-16)21-10-9-20-8-5-4-6-14(20)12-21/h11,14H,3-10,12H2,1-2H3,(H,17,18,19) |
| InChIKey | GMPRRVCCTPKNOY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |