C12H21N7 — CID 80929260
4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-hydrazinylpyrimidin-2-amine (PubChem CID 80929260) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-hydrazinylpyrimidin-2-amine.
| Compound Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-hydrazinylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80929260 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-6-hydrazinylpyrimidin-2-amine |
| SMILES | NNc1cc(N2CCN3CCCCC3C2)nc(N)n1 |
| InChI | InChI=1S/C12H21N7/c13-12-15-10(17-14)7-11(16-12)19-6-5-18-4-2-1-3-9(18)8-19/h7,9H,1-6,8,14H2,(H3,13,15,16,17) |
| InChIKey | ZGJKZUPIUICJKB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|