C15H26N6 — CID 80969411
[6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 80969411) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is [6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80969411 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | CC(C)c1nc(NN)cc(N2CCN3CCCCC3C2)n1 |
| InChI | InChI=1S/C15H26N6/c1-11(2)15-17-13(19-16)9-14(18-15)21-8-7-20-6-4-3-5-12(20)10-21/h9,11-12H,3-8,10,16H2,1-2H3,(H,17,18,19) |
| InChIKey | WYYAMDJCZLBJPS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|