C13H18F3N5 — CID 102720895
[6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102720895) has the molecular formula C13H18F3N5 and a molecular weight of 301.32 g/mol. Its IUPAC name is [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102720895 |
| Molecular Formula | C13H18F3N5 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | [6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)cc(N2CCN3CCCC3C2)n1 |
| InChI | InChI=1S/C13H18F3N5/c14-13(15,16)9-6-11(19-17)18-12(7-9)21-5-4-20-3-1-2-10(20)8-21/h6-7,10H,1-5,8,17H2,(H,18,19) |
| InChIKey | YGYZPNSEDXZPIT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|