C13H16ClF3N4 — CID 114562594
2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 114562594) has the molecular formula C13H16ClF3N4 and a molecular weight of 320.75 g/mol. Its IUPAC name is 2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 114562594 |
| Molecular Formula | C13H16ClF3N4 |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | FC(F)(F)c1cc(N2CCCN3CCCC3C2)nc(Cl)n1 |
| InChI | InChI=1S/C13H16ClF3N4/c14-12-18-10(13(15,16)17)7-11(19-12)21-6-2-5-20-4-1-3-9(20)8-21/h7,9H,1-6,8H2 |
| InChIKey | KIGJXLROHBHDFP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |